C30H39IO7Si — CID 162117324
3,4-dihydro-2H-pyran-6-yl-hydroxy-dimethylsilane;ethyl 4-(3,4-dihydro-2H-pyran-6-yl)benzoate;ethyl 4-iodobenzoate (PubChem CID 162117324) has the molecular formula C30H39IO7Si and a molecular weight of 666.63 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl-hydroxy-dimethylsilane;ethyl 4-(3,4-dihydro-2H-pyran-6-yl)benzoate;ethyl 4-iodobenzoate.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl-hydroxy-dimethylsilane;ethyl 4-(3,4-dihydro-2H-pyran-6-yl)benzoate;ethyl 4-iodobenzoate |
|---|---|
| PubChem CID | 162117324 |
| Molecular Formula | C30H39IO7Si |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl-hydroxy-dimethylsilane;ethyl 4-(3,4-dihydro-2H-pyran-6-yl)benzoate;ethyl 4-iodobenzoate |
| SMILES | CCOC(=O)c1ccc(C2=CCCCO2)cc1.CCOC(=O)c1ccc(I)cc1.C[Si](C)(O)C1=CCCCO1 |
| InChI | InChI=1S/C14H16O3.C9H9IO2.C7H14O2Si/c1-2-16-14(15)12-8-6-11(7-9-12)13-5-3-4-10-17-13;1-2-12-9(11)7-3-5-8(10)6-4-7;1-10(2,8)7-5-3-4-6-9-7/h5-9H,2-4,10H2,1H3;3-6H,2H2,1H3;5,8H,3-4,6H2,1-2H3 |
| InChIKey | ZGYCCMBYQGBLLS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|