C7H13NaO2Si — CID 71306630
sodium 3,4-dihydro-2H-pyran-6-yl-dimethyl-oxidosilane (PubChem CID 71306630) has the molecular formula C7H13NaO2Si and a molecular weight of 180.25 g/mol. Its IUPAC name is sodium 3,4-dihydro-2H-pyran-6-yl-dimethyl-oxidosilane.
| Compound Name | sodium 3,4-dihydro-2H-pyran-6-yl-dimethyl-oxidosilane |
|---|---|
| PubChem CID | 71306630 |
| Molecular Formula | C7H13NaO2Si |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | sodium 3,4-dihydro-2H-pyran-6-yl-dimethyl-oxidosilane |
| SMILES | C[Si](C)([O-])C1=CCCCO1.[Na+] |
| InChI | InChI=1S/C7H13O2Si.Na/c1-10(2,8)7-5-3-4-6-9-7;/h5H,3-4,6H2,1-2H3;/q-1;+1 |
| InChIKey | SLHBFPGELWKNMC-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|