C8H16AlLiO — CID 135050678
lithium 3,4-dihydro-2H-pyran-6-yl(trimethyl)alumanuide (PubChem CID 135050678) has the molecular formula C8H16AlLiO and a molecular weight of 162.14 g/mol. Its IUPAC name is lithium 3,4-dihydro-2H-pyran-6-yl(trimethyl)alumanuide.
| Compound Name | lithium 3,4-dihydro-2H-pyran-6-yl(trimethyl)alumanuide |
|---|---|
| PubChem CID | 135050678 |
| Molecular Formula | C8H16AlLiO |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | lithium 3,4-dihydro-2H-pyran-6-yl(trimethyl)alumanuide |
| SMILES | C[Al-](C)(C)C1=CCCCO1.[Li+] |
| InChI | InChI=1S/C5H7O.3CH3.Al.Li/c1-2-4-6-5-3-1;;;;;/h2H,1,3,5H2;3*1H3;;/q;;;;-1;+1 |
| InChIKey | JHJOOSGIMJRHRP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |