C5H6F2O — CID 54083806
5-(difluoromethyl)-2,3-dihydrofuran (PubChem CID 54083806) has the molecular formula C5H6F2O and a molecular weight of 120.10 g/mol. Its IUPAC name is 5-(difluoromethyl)-2,3-dihydrofuran.
| Compound Name | 5-(difluoromethyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 54083806 |
| Molecular Formula | C5H6F2O |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 5-(difluoromethyl)-2,3-dihydrofuran |
| SMILES | FC(F)C1=CCCO1 |
| InChI | InChI=1S/C5H6F2O/c6-5(7)4-2-1-3-8-4/h2,5H,1,3H2 |
| InChIKey | CNMWQFZJCRCVIW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |