C9H14O2 — CID 10844604
(6Z,8Z)-6,8-dimethyl-3,4-dihydro-2H-1,5-dioxonine (PubChem CID 10844604) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (6Z,8Z)-6,8-dimethyl-3,4-dihydro-2H-1,5-dioxonine.
| Compound Name | (6Z,8Z)-6,8-dimethyl-3,4-dihydro-2H-1,5-dioxonine |
|---|---|
| PubChem CID | 10844604 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (6Z,8Z)-6,8-dimethyl-3,4-dihydro-2H-1,5-dioxonine |
| SMILES | CC1=C/OCCCO/C(C)=C\1 |
| InChI | InChI=1S/C9H14O2/c1-8-6-9(2)11-5-3-4-10-7-8/h6-7H,3-5H2,1-2H3/b8-7-,9-6- |
| InChIKey | QBSGHZJBEFOKJN-QOCNPQIPSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |