C13H18N2O — CID 102654461
[2,3-dihydrofuran-5-yl-(3,5-dimethylphenyl)methyl]hydrazine (PubChem CID 102654461) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl-(3,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl-(3,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654461 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [2,3-dihydrofuran-5-yl-(3,5-dimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)cc(C(NN)C2=CCCO2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-9-6-10(2)8-11(7-9)13(15-14)12-4-3-5-16-12/h4,6-8,13,15H,3,5,14H2,1-2H3 |
| InChIKey | YHQCWLXZWBKWQI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|