C12H15BrN2O — CID 107986221
[(2-bromo-3-methylphenyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (PubChem CID 107986221) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is [(2-bromo-3-methylphenyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
| Compound Name | [(2-bromo-3-methylphenyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107986221 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | [(2-bromo-3-methylphenyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| SMILES | Cc1cccc(C(NN)C2=CCCO2)c1Br |
| InChI | InChI=1S/C12H15BrN2O/c1-8-4-2-5-9(11(8)13)12(15-14)10-6-3-7-16-10/h2,4-6,12,15H,3,7,14H2,1H3 |
| InChIKey | HYOCCUNIPQQBST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|