C11H15N3O — CID 102654162
2-[2,3-dihydrofuran-5-yl(hydrazinyl)methyl]aniline (PubChem CID 102654162) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[2,3-dihydrofuran-5-yl(hydrazinyl)methyl]aniline.
| Compound Name | 2-[2,3-dihydrofuran-5-yl(hydrazinyl)methyl]aniline |
|---|---|
| PubChem CID | 102654162 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-[2,3-dihydrofuran-5-yl(hydrazinyl)methyl]aniline |
| SMILES | NNC(C1=CCCO1)c1ccccc1N |
| InChI | InChI=1S/C11H15N3O/c12-9-5-2-1-4-8(9)11(14-13)10-6-3-7-15-10/h1-2,4-6,11,14H,3,7,12-13H2 |
| InChIKey | ZAYPEOZBHFBNMK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|