C9H12N2O2 — CID 102654121
[2,3-dihydrofuran-5-yl(furan-2-yl)methyl]hydrazine (PubChem CID 102654121) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(furan-2-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl(furan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654121 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(furan-2-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)c1ccco1 |
| InChI | InChI=1S/C9H12N2O2/c10-11-9(7-3-1-5-12-7)8-4-2-6-13-8/h1,3-5,9,11H,2,6,10H2 |
| InChIKey | YNPNYMAYNIZZQI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|