C12H17NO2 — CID 102651455
N-[2,3-dihydrofuran-5-yl(furan-2-yl)methyl]propan-1-amine (PubChem CID 102651455) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[2,3-dihydrofuran-5-yl(furan-2-yl)methyl]propan-1-amine.
| Compound Name | N-[2,3-dihydrofuran-5-yl(furan-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102651455 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[2,3-dihydrofuran-5-yl(furan-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCO1)c1ccco1 |
| InChI | InChI=1S/C12H17NO2/c1-2-7-13-12(10-5-3-8-14-10)11-6-4-9-15-11/h3,5-6,8,12-13H,2,4,7,9H2,1H3 |
| InChIKey | AFLZTYLBPCQZOH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |