C14H14F5NO — CID 102653283
N-[2,3-dihydrofuran-5-yl-(2,3,4,5,6-pentafluorophenyl)methyl]propan-1-amine (PubChem CID 102653283) has the molecular formula C14H14F5NO and a molecular weight of 307.26 g/mol. Its IUPAC name is N-[2,3-dihydrofuran-5-yl-(2,3,4,5,6-pentafluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[2,3-dihydrofuran-5-yl-(2,3,4,5,6-pentafluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102653283 |
| Molecular Formula | C14H14F5NO |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2,3-dihydrofuran-5-yl-(2,3,4,5,6-pentafluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCO1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F5NO/c1-2-5-20-14(7-4-3-6-21-7)8-9(15)11(17)13(19)12(18)10(8)16/h4,14,20H,2-3,5-6H2,1H3 |
| InChIKey | AEKSAGWMNQKDAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|