C7H11N5O — CID 102654183
[2,3-dihydrofuran-5-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine (PubChem CID 102654183) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654183 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)c1ncn[nH]1 |
| InChI | InChI=1S/C7H11N5O/c8-11-6(5-2-1-3-13-5)7-9-4-10-12-7/h2,4,6,11H,1,3,8H2,(H,9,10,12) |
| InChIKey | HTSBAXOIKIRJPA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|