C15H15N5 — CID 105230368
[(4-phenylphenyl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine (PubChem CID 105230368) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is [(4-phenylphenyl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine.
| Compound Name | [(4-phenylphenyl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105230368 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [(4-phenylphenyl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(-c2ccccc2)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C15H15N5/c16-19-14(15-17-10-18-20-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10,14,19H,16H2,(H,17,18,20) |
| InChIKey | LSMQHVREYUGYOV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|