C10H12N4 — CID 94888605
(2S)-2-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 94888605) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 94888605 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | NC[C@H](c1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H12N4/c11-6-9(10-12-7-13-14-10)8-4-2-1-3-5-8/h1-5,7,9H,6,11H2,(H,12,13,14)/t9-/m1/s1 |
| InChIKey | ZXISAWXDZAGXHF-SECBINFHSA-N |
| XLogP | 0.90 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |