C9H9ClN4 — CID 96995614
(S)-(4-chlorophenyl)-(1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 96995614) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is (S)-(4-chlorophenyl)-(1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | (S)-(4-chlorophenyl)-(1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 96995614 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (S)-(4-chlorophenyl)-(1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | N[C@@H](c1ccc(Cl)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H9ClN4/c10-7-3-1-6(2-4-7)8(11)9-12-5-13-14-9/h1-5,8H,11H2,(H,12,13,14)/t8-/m0/s1 |
| InChIKey | JGXXNPGLAMJPTK-QMMMGPOBSA-N |
| XLogP | 1.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |