C13H18N4O2 — CID 97052988
(R)-(3,4-diethoxyphenyl)-(1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 97052988) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (R)-(3,4-diethoxyphenyl)-(1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | (R)-(3,4-diethoxyphenyl)-(1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 97052988 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (R)-(3,4-diethoxyphenyl)-(1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | CCOc1ccc([C@@H](N)c2ncn[nH]2)cc1OCC |
| InChI | InChI=1S/C13H18N4O2/c1-3-18-10-6-5-9(7-11(10)19-4-2)12(14)13-15-8-16-17-13/h5-8,12H,3-4,14H2,1-2H3,(H,15,16,17)/t12-/m1/s1 |
| InChIKey | LPMCBHLKXFPGLH-GFCCVEGCSA-N |
| XLogP | 1.65 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |