C15H20N2O2S — CID 105143436
(3,4-diethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanamine (PubChem CID 105143436) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanamine.
| Compound Name | (3,4-diethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105143436 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (3,4-diethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanamine |
| SMILES | CCOc1ccc(C(N)c2csc(C)n2)cc1OCC |
| InChI | InChI=1S/C15H20N2O2S/c1-4-18-13-7-6-11(8-14(13)19-5-2)15(16)12-9-20-10(3)17-12/h6-9,15H,4-5,16H2,1-3H3 |
| InChIKey | OTZSVOSRGHAMJA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |