C13H19NO2 — CID 105000806
1-(3,4-diethoxyphenyl)prop-2-en-1-amine (PubChem CID 105000806) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)prop-2-en-1-amine.
| Compound Name | 1-(3,4-diethoxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 105000806 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)prop-2-en-1-amine |
| SMILES | C=CC(N)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H19NO2/c1-4-11(14)10-7-8-12(15-5-2)13(9-10)16-6-3/h4,7-9,11H,1,5-6,14H2,2-3H3 |
| InChIKey | MRLMSCAAAYQJOK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|