C13H13N5 — CID 81231338
(2-methylquinolin-6-yl)-(1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 81231338) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is (2-methylquinolin-6-yl)-(1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | (2-methylquinolin-6-yl)-(1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 81231338 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2-methylquinolin-6-yl)-(1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | Cc1ccc2cc(C(N)c3ncn[nH]3)ccc2n1 |
| InChI | InChI=1S/C13H13N5/c1-8-2-3-9-6-10(4-5-11(9)17-8)12(14)13-15-7-16-18-13/h2-7,12H,14H2,1H3,(H,15,16,18) |
| InChIKey | NGWWWGZTLFPAJI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |