C19H20N2 — CID 105020875
(2,3-dimethylphenyl)-(2-methylquinolin-6-yl)methanamine (PubChem CID 105020875) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(2-methylquinolin-6-yl)methanamine.
| Compound Name | (2,3-dimethylphenyl)-(2-methylquinolin-6-yl)methanamine |
|---|---|
| PubChem CID | 105020875 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2,3-dimethylphenyl)-(2-methylquinolin-6-yl)methanamine |
| SMILES | Cc1ccc2cc(C(N)c3cccc(C)c3C)ccc2n1 |
| InChI | InChI=1S/C19H20N2/c1-12-5-4-6-17(14(12)3)19(20)16-9-10-18-15(11-16)8-7-13(2)21-18/h4-11,19H,20H2,1-3H3 |
| InChIKey | OUQWASWPAYQSBA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |