C13H13F3N2 — CID 79016384
3,3,3-trifluoro-1-(2-methylquinolin-6-yl)propan-1-amine (PubChem CID 79016384) has the molecular formula C13H13F3N2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(2-methylquinolin-6-yl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-(2-methylquinolin-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 79016384 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3,3,3-trifluoro-1-(2-methylquinolin-6-yl)propan-1-amine |
| SMILES | Cc1ccc2cc(C(N)CC(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C13H13F3N2/c1-8-2-3-10-6-9(4-5-12(10)18-8)11(17)7-13(14,15)16/h2-6,11H,7,17H2,1H3 |
| InChIKey | MLXYVYWYIUNFIN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |