C15H20N2S — CID 81231833
1-(2-methylquinolin-6-yl)-2-propylsulfanylethanamine (PubChem CID 81231833) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 1-(2-methylquinolin-6-yl)-2-propylsulfanylethanamine.
| Compound Name | 1-(2-methylquinolin-6-yl)-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 81231833 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-(2-methylquinolin-6-yl)-2-propylsulfanylethanamine |
| SMILES | CCCSCC(N)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C15H20N2S/c1-3-8-18-10-14(16)12-6-7-15-13(9-12)5-4-11(2)17-15/h4-7,9,14H,3,8,10,16H2,1-2H3 |
| InChIKey | WKIWXFJYCRFPIF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|