C9H9N3O — CID 40540193
(R)-phenyl(1H-1,2,4-triazol-5-yl)methanol (PubChem CID 40540193) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is (R)-phenyl(1H-1,2,4-triazol-5-yl)methanol.
| Compound Name | (R)-phenyl(1H-1,2,4-triazol-5-yl)methanol |
|---|---|
| PubChem CID | 40540193 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (R)-phenyl(1H-1,2,4-triazol-5-yl)methanol |
| SMILES | O[C@H](c1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H9N3O/c13-8(9-10-6-11-12-9)7-4-2-1-3-5-7/h1-6,8,13H,(H,10,11,12)/t8-/m1/s1 |
| InChIKey | LMZVNLVHAMIVEJ-MRVPVSSYSA-N |
| XLogP | 0.89 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |