C12H12N6 — CID 105230361
[quinolin-8-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine (PubChem CID 105230361) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is [quinolin-8-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine.
| Compound Name | [quinolin-8-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105230361 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [quinolin-8-yl(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ncn[nH]1)c1cccc2cccnc12 |
| InChI | InChI=1S/C12H12N6/c13-17-11(12-15-7-16-18-12)9-5-1-3-8-4-2-6-14-10(8)9/h1-7,11,17H,13H2,(H,15,16,18) |
| InChIKey | JNHBARREUHIWLY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|