C13H12N4S — CID 105253658
[quinolin-8-yl(1,3-thiazol-5-yl)methyl]hydrazine (PubChem CID 105253658) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is [quinolin-8-yl(1,3-thiazol-5-yl)methyl]hydrazine.
| Compound Name | [quinolin-8-yl(1,3-thiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105253658 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [quinolin-8-yl(1,3-thiazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1cncs1)c1cccc2cccnc12 |
| InChI | InChI=1S/C13H12N4S/c14-17-13(11-7-15-8-18-11)10-5-1-3-9-4-2-6-16-12(9)10/h1-8,13,17H,14H2 |
| InChIKey | AHQKWFFXECTDMJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|