C10H12N4 — CID 105251994
[1H-imidazol-2-yl(phenyl)methyl]hydrazine (PubChem CID 105251994) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is [1H-imidazol-2-yl(phenyl)methyl]hydrazine.
| Compound Name | [1H-imidazol-2-yl(phenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105251994 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | [1H-imidazol-2-yl(phenyl)methyl]hydrazine |
| SMILES | NNC(c1ccccc1)c1ncc[nH]1 |
| InChI | InChI=1S/C10H12N4/c11-14-9(10-12-6-7-13-10)8-4-2-1-3-5-8/h1-7,9,14H,11H2,(H,12,13) |
| InChIKey | YRDQRYXISVACHW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|