C18H18N4O — CID 97306827
3-[[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]methyl]benzamide (PubChem CID 97306827) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-[[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]methyl]benzamide.
| Compound Name | 3-[[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 97306827 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-[[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN[C@@H](c2ccccc2)c2ncc[nH]2)c1 |
| InChI | InChI=1S/C18H18N4O/c19-17(23)15-8-4-5-13(11-15)12-22-16(18-20-9-10-21-18)14-6-2-1-3-7-14/h1-11,16,22H,12H2,(H2,19,23)(H,20,21)/t16-/m0/s1 |
| InChIKey | YHUIZQYMTYFSDH-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |