C18H19N5O3S — CID 168874708
3-[(2S)-2-(benzenesulfonamido)-2-(1H-imidazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 168874708) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-[(2S)-2-(benzenesulfonamido)-2-(1H-imidazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[(2S)-2-(benzenesulfonamido)-2-(1H-imidazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 168874708 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[(2S)-2-(benzenesulfonamido)-2-(1H-imidazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(C[C@H](NS(=O)(=O)c2ccccc2)c2ncc[nH]2)c1 |
| InChI | InChI=1S/C18H19N5O3S/c19-17(22-24)14-6-4-5-13(11-14)12-16(18-20-9-10-21-18)23-27(25,26)15-7-2-1-3-8-15/h1-11,16,23-24H,12H2,(H2,19,22)(H,20,21)/t16-/m0/s1 |
| InChIKey | IFDBUHJGEBPZFJ-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|