C27H32N6O3S2 — CID 174229842
3-[1-(benzenesulfonamido)-2-[7-[2-(dimethylamino)ethyl-methylamino]-1,3-benzothiazol-2-yl]ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 174229842) has the molecular formula C27H32N6O3S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is 3-[1-(benzenesulfonamido)-2-[7-[2-(dimethylamino)ethyl-methylamino]-1,3-benzothiazol-2-yl]ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[1-(benzenesulfonamido)-2-[7-[2-(dimethylamino)ethyl-methylamino]-1,3-benzothiazol-2-yl]ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 174229842 |
| Molecular Formula | C27H32N6O3S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-[1-(benzenesulfonamido)-2-[7-[2-(dimethylamino)ethyl-methylamino]-1,3-benzothiazol-2-yl]ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(C)CCN(C)c1cccc2nc(CC(NS(=O)(=O)c3ccccc3)c3cccc(C(N)=NO)c3)sc12 |
| InChI | InChI=1S/C27H32N6O3S2/c1-32(2)15-16-33(3)24-14-8-13-22-26(24)37-25(29-22)18-23(19-9-7-10-20(17-19)27(28)30-34)31-38(35,36)21-11-5-4-6-12-21/h4-14,17,23,31,34H,15-16,18H2,1-3H3,(H2,28,30) |
| InChIKey | MKDWRJPQOUUWDI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|