C22H20N4O4S2 — CID 168874697
3-[2-(benzenesulfonamido)-2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 168874697) has the molecular formula C22H20N4O4S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[2-(benzenesulfonamido)-2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[2-(benzenesulfonamido)-2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 168874697 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-[2-(benzenesulfonamido)-2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(CC(NS(=O)(=O)c2ccccc2)c2nc3ccc(O)cc3s2)c1 |
| InChI | InChI=1S/C22H20N4O4S2/c23-21(25-28)15-6-4-5-14(11-15)12-19(26-32(29,30)17-7-2-1-3-8-17)22-24-18-10-9-16(27)13-20(18)31-22/h1-11,13,19,26-28H,12H2,(H2,23,25) |
| InChIKey | RPRABSNRZKBJHD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|