C11H13N3 — CID 124512474
(1R)-1-(1H-imidazol-2-yl)-N-methyl-1-phenylmethanamine (PubChem CID 124512474) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (1R)-1-(1H-imidazol-2-yl)-N-methyl-1-phenylmethanamine.
| Compound Name | (1R)-1-(1H-imidazol-2-yl)-N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 124512474 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (1R)-1-(1H-imidazol-2-yl)-N-methyl-1-phenylmethanamine |
| SMILES | CN[C@H](c1ccccc1)c1ncc[nH]1 |
| InChI | InChI=1S/C11H13N3/c1-12-10(11-13-7-8-14-11)9-5-3-2-4-6-9/h2-8,10,12H,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | BMWHWEYKWBMGOV-SNVBAGLBSA-N |
| XLogP | 1.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |