C19H18N4O2 — CID 124572426
(2S)-6-[[(R)-1H-imidazol-2-yl(phenyl)methyl]amino]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 124572426) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (2S)-6-[[(R)-1H-imidazol-2-yl(phenyl)methyl]amino]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-6-[[(R)-1H-imidazol-2-yl(phenyl)methyl]amino]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 124572426 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2S)-6-[[(R)-1H-imidazol-2-yl(phenyl)methyl]amino]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2ccc(N[C@H](c3ccccc3)c3ncc[nH]3)cc2NC1=O |
| InChI | InChI=1S/C19H18N4O2/c1-12-19(24)23-15-11-14(7-8-16(15)25-12)22-17(18-20-9-10-21-18)13-5-3-2-4-6-13/h2-12,17,22H,1H3,(H,20,21)(H,23,24)/t12-,17+/m0/s1 |
| InChIKey | BLUNZYMAOIANNL-YVEFUNNKSA-N |
| XLogP | 3.33 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|