C14H19N3 — CID 13019465
3-(1H-imidazol-2-yl)-N,N-dimethyl-3-phenylpropan-1-amine (PubChem CID 13019465) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-(1H-imidazol-2-yl)-N,N-dimethyl-3-phenylpropan-1-amine.
| Compound Name | 3-(1H-imidazol-2-yl)-N,N-dimethyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 13019465 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3-(1H-imidazol-2-yl)-N,N-dimethyl-3-phenylpropan-1-amine |
| SMILES | CN(C)CCC(c1ccccc1)c1ncc[nH]1 |
| InChI | InChI=1S/C14H19N3/c1-17(2)11-8-13(14-15-9-10-16-14)12-6-4-3-5-7-12/h3-7,9-10,13H,8,11H2,1-2H3,(H,15,16) |
| InChIKey | XPYGFEIUAHHFQR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |