C13H19N3 — CID 19938699
N,N-dimethyl-1-phenylmethanamine;2-methyl-1H-imidazole (PubChem CID 19938699) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;2-methyl-1H-imidazole.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;2-methyl-1H-imidazole |
|---|---|
| PubChem CID | 19938699 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;2-methyl-1H-imidazole |
| SMILES | CN(C)Cc1ccccc1.Cc1ncc[nH]1 |
| InChI | InChI=1S/C9H13N.C4H6N2/c1-10(2)8-9-6-4-3-5-7-9;1-4-5-2-3-6-4/h3-7H,8H2,1-2H3;2-3H,1H3,(H,5,6) |
| InChIKey | YBMAIYZUVQQWFO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |