C10H10Cl2N4 — CID 105252174
[(2,5-dichlorophenyl)-(1H-imidazol-2-yl)methyl]hydrazine (PubChem CID 105252174) has the molecular formula C10H10Cl2N4 and a molecular weight of 257.12 g/mol. Its IUPAC name is [(2,5-dichlorophenyl)-(1H-imidazol-2-yl)methyl]hydrazine.
| Compound Name | [(2,5-dichlorophenyl)-(1H-imidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105252174 |
| Molecular Formula | C10H10Cl2N4 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | [(2,5-dichlorophenyl)-(1H-imidazol-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ncc[nH]1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H10Cl2N4/c11-6-1-2-8(12)7(5-6)9(16-13)10-14-3-4-15-10/h1-5,9,16H,13H2,(H,14,15) |
| InChIKey | KKBOBRTVWWMCRE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|