C9H11ClN6 — CID 105252211
5-chloro-3-[hydrazinyl(1H-imidazol-2-yl)methyl]pyridin-2-amine (PubChem CID 105252211) has the molecular formula C9H11ClN6 and a molecular weight of 238.68 g/mol. Its IUPAC name is 5-chloro-3-[hydrazinyl(1H-imidazol-2-yl)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[hydrazinyl(1H-imidazol-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105252211 |
| Molecular Formula | C9H11ClN6 |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5-chloro-3-[hydrazinyl(1H-imidazol-2-yl)methyl]pyridin-2-amine |
| SMILES | NNC(c1ncc[nH]1)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C9H11ClN6/c10-5-3-6(8(11)15-4-5)7(16-12)9-13-1-2-14-9/h1-4,7,16H,12H2,(H2,11,15)(H,13,14) |
| InChIKey | RUAVUTXIGFAEMI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|