C10H14ClN7 — CID 105230884
3-[(5-amino-1-methylpyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine (PubChem CID 105230884) has the molecular formula C10H14ClN7 and a molecular weight of 267.72 g/mol. Its IUPAC name is 3-[(5-amino-1-methylpyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine.
| Compound Name | 3-[(5-amino-1-methylpyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 105230884 |
| Molecular Formula | C10H14ClN7 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[(5-amino-1-methylpyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine |
| SMILES | Cn1ncc(C(NN)c2cc(Cl)cnc2N)c1N |
| InChI | InChI=1S/C10H14ClN7/c1-18-10(13)7(4-16-18)8(17-14)6-2-5(11)3-15-9(6)12/h2-4,8,17H,13-14H2,1H3,(H2,12,15) |
| InChIKey | SLLYRHULQQWIQI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|