C12H11Cl2FN4 — CID 105215434
5-chloro-3-[(2-chloro-4-fluorophenyl)-hydrazinylmethyl]pyridin-2-amine (PubChem CID 105215434) has the molecular formula C12H11Cl2FN4 and a molecular weight of 301.15 g/mol. Its IUPAC name is 5-chloro-3-[(2-chloro-4-fluorophenyl)-hydrazinylmethyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[(2-chloro-4-fluorophenyl)-hydrazinylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105215434 |
| Molecular Formula | C12H11Cl2FN4 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-chloro-3-[(2-chloro-4-fluorophenyl)-hydrazinylmethyl]pyridin-2-amine |
| SMILES | NNC(c1ccc(F)cc1Cl)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C12H11Cl2FN4/c13-6-3-9(12(16)18-5-6)11(19-17)8-2-1-7(15)4-10(8)14/h1-5,11,19H,17H2,(H2,16,18) |
| InChIKey | XJTKYPHPTUFYDK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|