C9H12ClN7 — CID 105231228
3-[(5-amino-1H-pyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine (PubChem CID 105231228) has the molecular formula C9H12ClN7 and a molecular weight of 253.70 g/mol. Its IUPAC name is 3-[(5-amino-1H-pyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine.
| Compound Name | 3-[(5-amino-1H-pyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 105231228 |
| Molecular Formula | C9H12ClN7 |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-[(5-amino-1H-pyrazol-4-yl)-hydrazinylmethyl]-5-chloropyridin-2-amine |
| SMILES | NNC(c1cc(Cl)cnc1N)c1cn[nH]c1N |
| InChI | InChI=1S/C9H12ClN7/c10-4-1-5(8(11)14-2-4)7(16-13)6-3-15-17-9(6)12/h1-3,7,16H,13H2,(H2,11,14)(H3,12,15,17) |
| InChIKey | UUBCUKHULLCULF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|