C10H12FN5 — CID 105231191
4-[(4-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine (PubChem CID 105231191) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(4-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231191 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-[(4-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
| SMILES | NNC(c1ccc(F)cc1)c1cn[nH]c1N |
| InChI | InChI=1S/C10H12FN5/c11-7-3-1-6(2-4-7)9(15-13)8-5-14-16-10(8)12/h1-5,9,15H,13H2,(H3,12,14,16) |
| InChIKey | MSSZUSGVIPQPLZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|