C10H11ClFN5 — CID 105397851
4-[(2-chloro-5-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine (PubChem CID 105397851) has the molecular formula C10H11ClFN5 and a molecular weight of 255.68 g/mol. Its IUPAC name is 4-[(2-chloro-5-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(2-chloro-5-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105397851 |
| Molecular Formula | C10H11ClFN5 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-[(2-chloro-5-fluorophenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
| SMILES | NNC(c1cc(F)ccc1Cl)c1cn[nH]c1N |
| InChI | InChI=1S/C10H11ClFN5/c11-8-2-1-5(12)3-6(8)9(16-14)7-4-15-17-10(7)13/h1-4,9,16H,14H2,(H3,13,15,17) |
| InChIKey | QKZHEKKZVOSDPP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|