C12H16BrN5O2 — CID 103524628
4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine (PubChem CID 103524628) has the molecular formula C12H16BrN5O2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 103524628 |
| Molecular Formula | C12H16BrN5O2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1H-pyrazol-5-amine |
| SMILES | COc1ccc(C(NN)c2cn[nH]c2N)c(OC)c1Br |
| InChI | InChI=1S/C12H16BrN5O2/c1-19-8-4-3-6(11(20-2)9(8)13)10(17-15)7-5-16-18-12(7)14/h3-5,10,17H,15H2,1-2H3,(H3,14,16,18) |
| InChIKey | FVRIJMCEDIBTOT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|