C13H18BrN5O2 — CID 103524627
4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine (PubChem CID 103524627) has the molecular formula C13H18BrN5O2 and a molecular weight of 356.22 g/mol. Its IUPAC name is 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 103524627 |
| Molecular Formula | C13H18BrN5O2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-[(3-bromo-2,4-dimethoxyphenyl)-hydrazinylmethyl]-1-methylpyrazol-5-amine |
| SMILES | COc1ccc(C(NN)c2cnn(C)c2N)c(OC)c1Br |
| InChI | InChI=1S/C13H18BrN5O2/c1-19-13(15)8(6-17-19)11(18-16)7-4-5-9(20-2)10(14)12(7)21-3/h4-6,11,18H,15-16H2,1-3H3 |
| InChIKey | UWRMEAZNUAUVLE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|