C13H19BrN2O3 — CID 103524623
[(3-bromo-2,4-dimethoxyphenyl)-(oxolan-2-yl)methyl]hydrazine (PubChem CID 103524623) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is [(3-bromo-2,4-dimethoxyphenyl)-(oxolan-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,4-dimethoxyphenyl)-(oxolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103524623 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | [(3-bromo-2,4-dimethoxyphenyl)-(oxolan-2-yl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)C2CCCO2)c(OC)c1Br |
| InChI | InChI=1S/C13H19BrN2O3/c1-17-9-6-5-8(13(18-2)11(9)14)12(16-15)10-4-3-7-19-10/h5-6,10,12,16H,3-4,7,15H2,1-2H3 |
| InChIKey | CENMLWBAZARNNB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|