C14H21BrN2O3 — CID 103524743
[(3-bromo-2,4-dimethoxyphenyl)-(2-methyloxolan-3-yl)methyl]hydrazine (PubChem CID 103524743) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is [(3-bromo-2,4-dimethoxyphenyl)-(2-methyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,4-dimethoxyphenyl)-(2-methyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103524743 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(3-bromo-2,4-dimethoxyphenyl)-(2-methyloxolan-3-yl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)C2CCOC2C)c(OC)c1Br |
| InChI | InChI=1S/C14H21BrN2O3/c1-8-9(6-7-20-8)13(17-16)10-4-5-11(18-2)12(15)14(10)19-3/h4-5,8-9,13,17H,6-7,16H2,1-3H3 |
| InChIKey | RFBTUWVGEZPWHK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|