C11H13ClN6 — CID 105260556
5-chloro-3-[hydrazinyl-(2-methylpyrimidin-4-yl)methyl]pyridin-2-amine (PubChem CID 105260556) has the molecular formula C11H13ClN6 and a molecular weight of 264.72 g/mol. Its IUPAC name is 5-chloro-3-[hydrazinyl-(2-methylpyrimidin-4-yl)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[hydrazinyl-(2-methylpyrimidin-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105260556 |
| Molecular Formula | C11H13ClN6 |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-chloro-3-[hydrazinyl-(2-methylpyrimidin-4-yl)methyl]pyridin-2-amine |
| SMILES | Cc1nccc(C(NN)c2cc(Cl)cnc2N)n1 |
| InChI | InChI=1S/C11H13ClN6/c1-6-15-3-2-9(17-6)10(18-14)8-4-7(12)5-16-11(8)13/h2-5,10,18H,14H2,1H3,(H2,13,16) |
| InChIKey | ACXRGRAHQNGLGS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|