C9H8Cl2N4S — CID 105301984
[(2,5-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine (PubChem CID 105301984) has the molecular formula C9H8Cl2N4S and a molecular weight of 275.16 g/mol. Its IUPAC name is [(2,5-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine.
| Compound Name | [(2,5-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105301984 |
| Molecular Formula | C9H8Cl2N4S |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | [(2,5-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1cnsn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2N4S/c10-5-1-2-7(11)6(3-5)9(14-12)8-4-13-16-15-8/h1-4,9,14H,12H2 |
| InChIKey | HCFZDQMOAWODCG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|