C10H10F3N5O — CID 105230561
[1H-1,2,4-triazol-5-yl-[2-(trifluoromethoxy)phenyl]methyl]hydrazine (PubChem CID 105230561) has the molecular formula C10H10F3N5O and a molecular weight of 273.22 g/mol. Its IUPAC name is [1H-1,2,4-triazol-5-yl-[2-(trifluoromethoxy)phenyl]methyl]hydrazine.
| Compound Name | [1H-1,2,4-triazol-5-yl-[2-(trifluoromethoxy)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105230561 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [1H-1,2,4-triazol-5-yl-[2-(trifluoromethoxy)phenyl]methyl]hydrazine |
| SMILES | NNC(c1ncn[nH]1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3N5O/c11-10(12,13)19-7-4-2-1-3-6(7)8(17-14)9-15-5-16-18-9/h1-5,8,17H,14H2,(H,15,16,18) |
| InChIKey | HCEQGQANDPSHFO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|