C9H14N4O — CID 102650085
[3,4-dihydro-2H-pyran-6-yl(1H-imidazol-2-yl)methyl]hydrazine (PubChem CID 102650085) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl(1H-imidazol-2-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl(1H-imidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102650085 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl(1H-imidazol-2-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)c1ncc[nH]1 |
| InChI | InChI=1S/C9H14N4O/c10-13-8(9-11-4-5-12-9)7-3-1-2-6-14-7/h3-5,8,13H,1-2,6,10H2,(H,11,12) |
| InChIKey | YQSWKPPEIRBALH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|