C10H16N4O — CID 102650002
[3,4-dihydro-2H-pyran-6-yl-(1-methylpyrazol-3-yl)methyl]hydrazine (PubChem CID 102650002) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl-(1-methylpyrazol-3-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl-(1-methylpyrazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102650002 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl-(1-methylpyrazol-3-yl)methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)C2=CCCCO2)n1 |
| InChI | InChI=1S/C10H16N4O/c1-14-6-5-8(13-14)10(12-11)9-4-2-3-7-15-9/h4-6,10,12H,2-3,7,11H2,1H3 |
| InChIKey | VVLQSQRGBAZROS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|